C31H33Cl2N5O4 — CID 10232598
(2S)-2-[[amino-[2-(cyclohexylmethylcarbamoyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid (PubChem CID 10232598) has the molecular formula C31H33Cl2N5O4 and a molecular weight of 610.54 g/mol. Its IUPAC name is (2S)-2-[[amino-[2-(cyclohexylmethylcarbamoyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[amino-[2-(cyclohexylmethylcarbamoyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10232598 |
| Molecular Formula | C31H33Cl2N5O4 |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | (2S)-2-[[amino-[2-(cyclohexylmethylcarbamoyl)anilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoic acid |
| SMILES | N/C(=N\[C@@H](Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)C(=O)O)Nc1ccccc1C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C31H33Cl2N5O4/c32-23-10-6-11-24(33)27(23)29(40)36-21-15-13-19(14-16-21)17-26(30(41)42)38-31(34)37-25-12-5-4-9-22(25)28(39)35-18-20-7-2-1-3-8-20/h4-6,9-16,20,26H,1-3,7-8,17-18H2,(H,35,39)(H,36,40)(H,41,42)(H3,34,37,38)/t26-/m0/s1 |
| InChIKey | QUEWSEUPAKCWCG-SANMLTNESA-N |
| XLogP | 5.98 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|