C35H41Cl2N5O5 — CID 69377024
2-[[[2-(cyclohexylmethylcarbamoyl)phenyl]-pentylcarbamoyl]amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoic acid (PubChem CID 69377024) has the molecular formula C35H41Cl2N5O5 and a molecular weight of 682.65 g/mol. Its IUPAC name is 2-[[[2-(cyclohexylmethylcarbamoyl)phenyl]-pentylcarbamoyl]amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | 2-[[[2-(cyclohexylmethylcarbamoyl)phenyl]-pentylcarbamoyl]amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69377024 |
| Molecular Formula | C35H41Cl2N5O5 |
| Molecular Weight | 682.65 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | 2-[[[2-(cyclohexylmethylcarbamoyl)phenyl]-pentylcarbamoyl]amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoic acid |
| SMILES | CCCCCN(C(=O)NC(Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)C(=O)O)c1ccccc1C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C35H41Cl2N5O5/c1-2-3-9-18-42(30-13-8-7-12-26(30)32(43)39-20-24-10-5-4-6-11-24)35(47)41-29(34(45)46)19-23-14-16-25(17-15-23)40-33(44)31-27(36)21-38-22-28(31)37/h7-8,12-17,21-22,24,29H,2-6,9-11,18-20H2,1H3,(H,39,43)(H,40,44)(H,41,47)(H,45,46) |
| InChIKey | MCHXKVOUQRHKPA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.65 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|