C24H27Cl2N5O4 — CID 122533156
(2S)-3-[4-[[4-(diaminomethylideneamino)cyclohexanecarbonyl]amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoic acid (PubChem CID 122533156) has the molecular formula C24H27Cl2N5O4 and a molecular weight of 520.42 g/mol. Its IUPAC name is (2S)-3-[4-[[4-(diaminomethylideneamino)cyclohexanecarbonyl]amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoic acid.
| Compound Name | (2S)-3-[4-[[4-(diaminomethylideneamino)cyclohexanecarbonyl]amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 122533156 |
| Molecular Formula | C24H27Cl2N5O4 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (2S)-3-[4-[[4-(diaminomethylideneamino)cyclohexanecarbonyl]amino]phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoic acid |
| SMILES | NC(N)=NC1CCC(C(=O)Nc2ccc(C[C@H](NC(=O)c3c(Cl)cccc3Cl)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C24H27Cl2N5O4/c25-17-2-1-3-18(26)20(17)22(33)31-19(23(34)35)12-13-4-8-15(9-5-13)29-21(32)14-6-10-16(11-7-14)30-24(27)28/h1-5,8-9,14,16,19H,6-7,10-12H2,(H,29,32)(H,31,33)(H,34,35)(H4,27,28,30)/t14?,16?,19-/m0/s1 |
| InChIKey | DAYCPXRCQUQEKK-KJXMEXGPSA-N |
| XLogP | 3.19 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|