C26H30Cl2N4O4 — CID 158044788
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[(1S,3S)-3-[(N,N'-dimethylcarbamimidoyl)amino]cyclopentyl]-2-oxoethyl]phenyl]propanoic acid (PubChem CID 158044788) has the molecular formula C26H30Cl2N4O4 and a molecular weight of 533.46 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[(1S,3S)-3-[(N,N'-dimethylcarbamimidoyl)amino]cyclopentyl]-2-oxoethyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[(1S,3S)-3-[(N,N'-dimethylcarbamimidoyl)amino]cyclopentyl]-2-oxoethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 158044788 |
| Molecular Formula | C26H30Cl2N4O4 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-[(1S,3S)-3-[(N,N'-dimethylcarbamimidoyl)amino]cyclopentyl]-2-oxoethyl]phenyl]propanoic acid |
| SMILES | C/N=C(\NC)N[C@H]1CC[C@H](C(=O)Cc2ccc(C[C@H](NC(=O)c3c(Cl)cccc3Cl)C(=O)O)cc2)C1 |
| InChI | InChI=1S/C26H30Cl2N4O4/c1-29-26(30-2)31-18-11-10-17(14-18)22(33)13-16-8-6-15(7-9-16)12-21(25(35)36)32-24(34)23-19(27)4-3-5-20(23)28/h3-9,17-18,21H,10-14H2,1-2H3,(H,32,34)(H,35,36)(H2,29,30,31)/t17-,18-,21-/m0/s1 |
| InChIKey | QGYMRQXLUAJKGR-WFXMLNOXSA-N |
| XLogP | 3.49 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|