C26H23Cl2NO7 — CID 54317742
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[5-(2-methoxyethoxy)-1,3-benzodioxol-4-yl]phenyl]propanoic acid (PubChem CID 54317742) has the molecular formula C26H23Cl2NO7 and a molecular weight of 532.38 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[5-(2-methoxyethoxy)-1,3-benzodioxol-4-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[5-(2-methoxyethoxy)-1,3-benzodioxol-4-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54317742 |
| Molecular Formula | C26H23Cl2NO7 |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[5-(2-methoxyethoxy)-1,3-benzodioxol-4-yl]phenyl]propanoic acid |
| SMILES | COCCOc1ccc2c(c1-c1ccc(C[C@H](NC(=O)c3c(Cl)cccc3Cl)C(=O)O)cc1)OCO2 |
| InChI | InChI=1S/C26H23Cl2NO7/c1-33-11-12-34-20-9-10-21-24(36-14-35-21)22(20)16-7-5-15(6-8-16)13-19(26(31)32)29-25(30)23-17(27)3-2-4-18(23)28/h2-10,19H,11-14H2,1H3,(H,29,30)(H,31,32)/t19-/m0/s1 |
| InChIKey | SPKXVCJCIFSIMZ-IBGZPJMESA-N |
| XLogP | 4.84 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|