C24H27Cl2N3O3 — CID 143591478
2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]propyl]phenyl]propanoic acid (PubChem CID 143591478) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]propyl]phenyl]propanoic acid.
| Compound Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]propyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143591478 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[3-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]propyl]phenyl]propanoic acid |
| SMILES | C/C=C\C(=N/C)NCCCc1ccc(CC(NC(=O)c2c(Cl)cccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-3-6-21(27-2)28-14-5-7-16-10-12-17(13-11-16)15-20(24(31)32)29-23(30)22-18(25)8-4-9-19(22)26/h3-4,6,8-13,20H,5,7,14-15H2,1-2H3,(H,27,28)(H,29,30)(H,31,32)/b6-3- |
| InChIKey | ZAPRMKCFGYATAS-UTCJRWHESA-N |
| XLogP | 4.55 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|