C30H25Cl2N5O7S — CID 10190001
methyl (2S)-2-[[amino-[4-(4-nitrophenyl)sulfonylanilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate (PubChem CID 10190001) has the molecular formula C30H25Cl2N5O7S and a molecular weight of 670.53 g/mol. Its IUPAC name is methyl (2S)-2-[[amino-[4-(4-nitrophenyl)sulfonylanilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[[amino-[4-(4-nitrophenyl)sulfonylanilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 10190001 |
| Molecular Formula | C30H25Cl2N5O7S |
| Molecular Weight | 670.53 g/mol |
| Exact Mass | 669.09 |
| IUPAC Name | methyl (2S)-2-[[amino-[4-(4-nitrophenyl)sulfonylanilino]methylidene]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)/N=C(\N)Nc1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H25Cl2N5O7S/c1-44-29(39)26(17-18-5-7-19(8-6-18)34-28(38)27-24(31)3-2-4-25(27)32)36-30(33)35-20-9-13-22(14-10-20)45(42,43)23-15-11-21(12-16-23)37(40)41/h2-16,26H,17H2,1H3,(H,34,38)(H3,33,35,36)/t26-/m0/s1 |
| InChIKey | YXNNGXGDSZYVBB-SANMLTNESA-N |
| XLogP | 5.50 |
| TPSA | 183.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|