C21H19N3O7S — CID 164629093
2-amino-N-(3,4-dimethoxyphenyl)-6-(4-nitrophenyl)sulfonylbenzamide (PubChem CID 164629093) has the molecular formula C21H19N3O7S and a molecular weight of 457.46 g/mol. Its IUPAC name is 2-amino-N-(3,4-dimethoxyphenyl)-6-(4-nitrophenyl)sulfonylbenzamide.
| Compound Name | 2-amino-N-(3,4-dimethoxyphenyl)-6-(4-nitrophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 164629093 |
| Molecular Formula | C21H19N3O7S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-amino-N-(3,4-dimethoxyphenyl)-6-(4-nitrophenyl)sulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2c(N)cccc2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C21H19N3O7S/c1-30-17-11-6-13(12-18(17)31-2)23-21(25)20-16(22)4-3-5-19(20)32(28,29)15-9-7-14(8-10-15)24(26)27/h3-12H,22H2,1-2H3,(H,23,25) |
| InChIKey | HQSNQWHWMFPNLF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|