C30H20Cl4N2O5S — CID 18896078
2-[[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18896078) has the molecular formula C30H20Cl4N2O5S and a molecular weight of 662.38 g/mol. Its IUPAC name is 2-[[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18896078 |
| Molecular Formula | C30H20Cl4N2O5S |
| Molecular Weight | 662.38 g/mol |
| Exact Mass | 659.98 |
| IUPAC Name | 2-[[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | CC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H20Cl4N2O5S/c1-15(37)16-10-12-18(13-11-16)35-29(39)27(17-6-3-2-4-7-17)42-20-9-5-8-19(14-20)36-28(38)21-22(30(40)41)24(32)26(34)25(33)23(21)31/h2-14,27H,1H3,(H,35,39)(H,36,38)(H,40,41) |
| InChIKey | TXVUYWMBUWFOQG-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.38 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|