C23H17Cl4N3O6S2 — CID 22785462
2,3,4,5-tetrachloro-6-[[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22785462) has the molecular formula C23H17Cl4N3O6S2 and a molecular weight of 637.35 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22785462 |
| Molecular Formula | C23H17Cl4N3O6S2 |
| Molecular Weight | 637.35 g/mol |
| Exact Mass | 634.93 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H17Cl4N3O6S2/c1-10(21(31)29-12-4-8-14(9-5-12)38(28,35)36)37-13-6-2-11(3-7-13)30-22(32)15-16(23(33)34)18(25)20(27)19(26)17(15)24/h2-10H,1H3,(H,29,31)(H,30,32)(H,33,34)(H2,28,35,36) |
| InChIKey | GBTSHFNGTWGMCC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.35 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|