C14H6Cl5NO3 — CID 5211269
2,3,4,5-tetrachloro-6-[(3-chlorophenyl)carbamoyl]benzoic acid (PubChem CID 5211269) has the molecular formula C14H6Cl5NO3 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[(3-chlorophenyl)carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[(3-chlorophenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 5211269 |
| Molecular Formula | C14H6Cl5NO3 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[(3-chlorophenyl)carbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H6Cl5NO3/c15-5-2-1-3-6(4-5)20-13(21)7-8(14(22)23)10(17)12(19)11(18)9(7)16/h1-4H,(H,20,21)(H,22,23) |
| InChIKey | GYJDWWMQQUHLDN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|