C19H12Cl4N4O4S2 — CID 22784870
2,3,4,5-tetrachloro-6-[[4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22784870) has the molecular formula C19H12Cl4N4O4S2 and a molecular weight of 566.28 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22784870 |
| Molecular Formula | C19H12Cl4N4O4S2 |
| Molecular Weight | 566.28 g/mol |
| Exact Mass | 563.91 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | Cc1nnc(NC(=O)CSc2ccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)cc2)s1 |
| InChI | InChI=1S/C19H12Cl4N4O4S2/c1-7-26-27-19(33-7)25-10(28)6-32-9-4-2-8(3-5-9)24-17(29)11-12(18(30)31)14(21)16(23)15(22)13(11)20/h2-5H,6H2,1H3,(H,24,29)(H,30,31)(H,25,27,28) |
| InChIKey | ULHAGEVTPJBCDV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.28 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|