C25H17Cl4N3O5S2 — CID 18898582
2,3,4,5-tetrachloro-6-[[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18898582) has the molecular formula C25H17Cl4N3O5S2 and a molecular weight of 645.37 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18898582 |
| Molecular Formula | C25H17Cl4N3O5S2 |
| Molecular Weight | 645.37 g/mol |
| Exact Mass | 642.94 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCOc1ccc2nc(NC(=O)CSc3cccc(NC(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C(=O)O)c3)sc2c1 |
| InChI | InChI=1S/C25H17Cl4N3O5S2/c1-2-37-12-6-7-14-15(9-12)39-25(31-14)32-16(33)10-38-13-5-3-4-11(8-13)30-23(34)17-18(24(35)36)20(27)22(29)21(28)19(17)26/h3-9H,2,10H2,1H3,(H,30,34)(H,35,36)(H,31,32,33) |
| InChIKey | NJEQDNPYTFXFFD-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.37 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|