C35H33N5O4S2 — CID 19319838
N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319838) has the molecular formula C35H33N5O4S2 and a molecular weight of 651.81 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319838 |
| Molecular Formula | C35H33N5O4S2 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc2nc(NC(=O)CSc3cccc(NC(=O)/C(=C\c4ccc(N(C)C)cc4)NC(=O)c4ccccc4)c3)sc2c1 |
| InChI | InChI=1S/C35H33N5O4S2/c1-4-44-27-17-18-29-31(21-27)46-35(38-29)39-32(41)22-45-28-12-8-11-25(20-28)36-34(43)30(37-33(42)24-9-6-5-7-10-24)19-23-13-15-26(16-14-23)40(2)3/h5-21H,4,22H2,1-3H3,(H,36,43)(H,37,42)(H,38,39,41)/b30-19+ |
| InChIKey | WGVHGHYDAAZZDP-NDZAJKAJSA-N |
| XLogP | 6.90 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|