C24H22N4O2S3 — CID 19712680
N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19712680) has the molecular formula C24H22N4O2S3 and a molecular weight of 494.67 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712680 |
| Molecular Formula | C24H22N4O2S3 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | CCOc1ccc2nc(NC(=O)CSc3ccc(NC(=S)Nc4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C24H22N4O2S3/c1-2-30-18-10-13-20-21(14-18)33-24(27-20)28-22(29)15-32-19-11-8-17(9-12-19)26-23(31)25-16-6-4-3-5-7-16/h3-14H,2,15H2,1H3,(H2,25,26,31)(H,27,28,29) |
| InChIKey | JUDGFVGBVDYWQK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|