C23H18N4O5S2 — CID 18913304
N-[3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18913304) has the molecular formula C23H18N4O5S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18913304 |
| Molecular Formula | C23H18N4O5S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | COc1ccc2nc(NC(=O)CSc3cccc(NC(=O)c4cccc([N+](=O)[O-])c4)c3)sc2c1 |
| InChI | InChI=1S/C23H18N4O5S2/c1-32-17-8-9-19-20(12-17)34-23(25-19)26-21(28)13-33-18-7-3-5-15(11-18)24-22(29)14-4-2-6-16(10-14)27(30)31/h2-12H,13H2,1H3,(H,24,29)(H,25,26,28) |
| InChIKey | QSRBJGHKTIKXKF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|