C26H17Cl4N3O5S2 — CID 18895142
2,3,4,5-tetrachloro-6-[[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895142) has the molecular formula C26H17Cl4N3O5S2 and a molecular weight of 657.38 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895142 |
| Molecular Formula | C26H17Cl4N3O5S2 |
| Molecular Weight | 657.38 g/mol |
| Exact Mass | 654.94 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COc1ccccc1-c1csc(NC(=O)CSc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)n1 |
| InChI | InChI=1S/C26H17Cl4N3O5S2/c1-38-16-8-3-2-7-14(16)15-10-40-26(32-15)33-17(34)11-39-13-6-4-5-12(9-13)31-24(35)18-19(25(36)37)21(28)23(30)22(29)20(18)27/h2-10H,11H2,1H3,(H,31,35)(H,36,37)(H,32,33,34) |
| InChIKey | BMHUHJNPPLUXSH-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.38 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|