C22H26ClN3OS — CID 9423812
[2-(5-chloro-2-methylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate (PubChem CID 9423812) has the molecular formula C22H26ClN3OS and a molecular weight of 415.99 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate |
|---|---|
| PubChem CID | 9423812 |
| Molecular Formula | C22H26ClN3OS |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CS/C(=N\c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C22H26ClN3OS/c1-17-11-12-18(23)15-20(17)25-21(27)16-28-22(24-19-9-5-4-6-10-19)26-13-7-2-3-8-14-26/h4-6,9-12,15H,2-3,7-8,13-14,16H2,1H3,(H,25,27)/b24-22- |
| InChIKey | UCTUAXSWABOGAG-GYHWCHFESA-N |
| XLogP | 5.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|