C15H12BrNOS2 — CID 82973200
1-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-bromophenyl]ethanol (PubChem CID 82973200) has the molecular formula C15H12BrNOS2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-bromophenyl]ethanol.
| Compound Name | 1-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-bromophenyl]ethanol |
|---|---|
| PubChem CID | 82973200 |
| Molecular Formula | C15H12BrNOS2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-ylsulfanyl)-4-bromophenyl]ethanol |
| SMILES | CC(O)c1ccc(Br)cc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12BrNOS2/c1-9(18)11-7-6-10(16)8-14(11)20-15-17-12-4-2-3-5-13(12)19-15/h2-9,18H,1H3 |
| InChIKey | JEZQKXHSVRIAJW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |