C13H7BrCl2O2S — CID 114888813
2-bromo-6-(3,4-dichlorophenyl)sulfanylbenzoic acid (PubChem CID 114888813) has the molecular formula C13H7BrCl2O2S and a molecular weight of 378.07 g/mol. Its IUPAC name is 2-bromo-6-(3,4-dichlorophenyl)sulfanylbenzoic acid.
| Compound Name | 2-bromo-6-(3,4-dichlorophenyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 114888813 |
| Molecular Formula | C13H7BrCl2O2S |
| Molecular Weight | 378.07 g/mol |
| Exact Mass | 375.87 |
| IUPAC Name | 2-bromo-6-(3,4-dichlorophenyl)sulfanylbenzoic acid |
| SMILES | O=C(O)c1c(Br)cccc1Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H7BrCl2O2S/c14-8-2-1-3-11(12(8)13(17)18)19-7-4-5-9(15)10(16)6-7/h1-6H,(H,17,18) |
| InChIKey | XNIYZRBEBSTYKQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.07 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |