C20H22Cl2N2O11 — CID 158238817
4-chloro-3-nitrobenzoic acid;2-methoxyethanol;2-methoxyethyl 4-chloro-3-nitrobenzoate (PubChem CID 158238817) has the molecular formula C20H22Cl2N2O11 and a molecular weight of 537.31 g/mol. Its IUPAC name is 4-chloro-3-nitrobenzoic acid;2-methoxyethanol;2-methoxyethyl 4-chloro-3-nitrobenzoate.
| Compound Name | 4-chloro-3-nitrobenzoic acid;2-methoxyethanol;2-methoxyethyl 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 158238817 |
| Molecular Formula | C20H22Cl2N2O11 |
| Molecular Weight | 537.31 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 4-chloro-3-nitrobenzoic acid;2-methoxyethanol;2-methoxyethyl 4-chloro-3-nitrobenzoate |
| SMILES | COCCO.COCCOC(=O)c1ccc(Cl)c([N+](=O)[O-])c1.O=C(O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10ClNO5.C7H4ClNO4.C3H8O2/c1-16-4-5-17-10(13)7-2-3-8(11)9(6-7)12(14)15;8-5-2-1-4(7(10)11)3-6(5)9(12)13;1-5-3-2-4/h2-3,6H,4-5H2,1H3;1-3H,(H,10,11);4H,2-3H2,1H3 |
| InChIKey | GFHKCKDTUVAGQQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|