C16H22N3O3+ — CID 19820566
3-[(8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl)methyl]-4-nitrobenzamide (PubChem CID 19820566) has the molecular formula C16H22N3O3+ and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-[(8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl)methyl]-4-nitrobenzamide.
| Compound Name | 3-[(8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl)methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 19820566 |
| Molecular Formula | C16H22N3O3+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-[(8-methyl-8-azoniabicyclo[3.2.1]octan-8-yl)methyl]-4-nitrobenzamide |
| SMILES | C[N+]1(Cc2cc(C(N)=O)ccc2[N+](=O)[O-])C2CCCC1CC2 |
| InChI | InChI=1S/C16H21N3O3/c1-19(13-3-2-4-14(19)7-6-13)10-12-9-11(16(17)20)5-8-15(12)18(21)22/h5,8-9,13-14H,2-4,6-7,10H2,1H3,(H-,17,20)/p+1 |
| InChIKey | KVGJTOSKWVHYTP-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|