C28H30N4O7 — CID 162140434
4-[(E)-5-[2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-3,4-dimethylpent-3-enyl]-3-nitrobenzamide (PubChem CID 162140434) has the molecular formula C28H30N4O7 and a molecular weight of 534.57 g/mol. Its IUPAC name is 4-[(E)-5-[2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-3,4-dimethylpent-3-enyl]-3-nitrobenzamide.
| Compound Name | 4-[(E)-5-[2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-3,4-dimethylpent-3-enyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 162140434 |
| Molecular Formula | C28H30N4O7 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 4-[(E)-5-[2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-3,4-dimethylpent-3-enyl]-3-nitrobenzamide |
| SMILES | COc1ccc(COc2cccc([N+](=O)[O-])c2NC/C(C)=C(\C)CCc2ccc(C(N)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H30N4O7/c1-18(7-10-21-11-12-22(28(29)33)15-25(21)32(36)37)19(2)16-30-27-24(31(34)35)5-4-6-26(27)39-17-20-8-13-23(38-3)14-9-20/h4-6,8-9,11-15,30H,7,10,16-17H2,1-3H3,(H2,29,33)/b19-18+ |
| InChIKey | DOSIDWYSBPVTPG-VHEBQXMUSA-N |
| XLogP | 5.57 |
| TPSA | 159.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|