C17H21N4O3+ — CID 7774626
[(1R)-2-(4-carbamoyl-2-nitroanilino)-1-phenylethyl]-dimethylazanium (PubChem CID 7774626) has the molecular formula C17H21N4O3+ and a molecular weight of 329.38 g/mol. Its IUPAC name is [(1R)-2-(4-carbamoyl-2-nitroanilino)-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-(4-carbamoyl-2-nitroanilino)-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7774626 |
| Molecular Formula | C17H21N4O3+ |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(1R)-2-(4-carbamoyl-2-nitroanilino)-1-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNc1ccc(C(N)=O)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H20N4O3/c1-20(2)16(12-6-4-3-5-7-12)11-19-14-9-8-13(17(18)22)10-15(14)21(23)24/h3-10,16,19H,11H2,1-2H3,(H2,18,22)/p+1/t16-/m0/s1 |
| InChIKey | QSIWZLHMPOYWQD-INIZCTEOSA-O |
| XLogP | 0.99 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|