C17H10Br2N2O2S — CID 102471987
(4-phenyldiazenylphenyl) 2,5-dibromothiophene-3-carboxylate (PubChem CID 102471987) has the molecular formula C17H10Br2N2O2S and a molecular weight of 466.15 g/mol. Its IUPAC name is (4-phenyldiazenylphenyl) 2,5-dibromothiophene-3-carboxylate.
| Compound Name | (4-phenyldiazenylphenyl) 2,5-dibromothiophene-3-carboxylate |
|---|---|
| PubChem CID | 102471987 |
| Molecular Formula | C17H10Br2N2O2S |
| Molecular Weight | 466.15 g/mol |
| Exact Mass | 463.88 |
| IUPAC Name | (4-phenyldiazenylphenyl) 2,5-dibromothiophene-3-carboxylate |
| SMILES | O=C(Oc1ccc(/N=N/c2ccccc2)cc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C17H10Br2N2O2S/c18-15-10-14(16(19)24-15)17(22)23-13-8-6-12(7-9-13)21-20-11-4-2-1-3-5-11/h1-10H/b21-20+ |
| InChIKey | MODJTDXEEYBVER-QZQOTICOSA-N |
| XLogP | 6.91 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.15 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|