C15H14N4O4 — CID 142130881
2-amino-3-[4-(diaminomethylideneamino)phenoxy]carbonylbenzoic acid (PubChem CID 142130881) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-amino-3-[4-(diaminomethylideneamino)phenoxy]carbonylbenzoic acid.
| Compound Name | 2-amino-3-[4-(diaminomethylideneamino)phenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 142130881 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-amino-3-[4-(diaminomethylideneamino)phenoxy]carbonylbenzoic acid |
| SMILES | NC(N)=Nc1ccc(OC(=O)c2cccc(C(=O)O)c2N)cc1 |
| InChI | InChI=1S/C15H14N4O4/c16-12-10(13(20)21)2-1-3-11(12)14(22)23-9-6-4-8(5-7-9)19-15(17)18/h1-7H,16H2,(H,20,21)(H4,17,18,19) |
| InChIKey | SGRKSGWIFGHBSN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 154.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|