C18H21N3O5 — CID 70542197
3-acetyl-2-hydroxybenzoic acid;2-(4-ethoxyphenyl)guanidine (PubChem CID 70542197) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-acetyl-2-hydroxybenzoic acid;2-(4-ethoxyphenyl)guanidine.
| Compound Name | 3-acetyl-2-hydroxybenzoic acid;2-(4-ethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 70542197 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-acetyl-2-hydroxybenzoic acid;2-(4-ethoxyphenyl)guanidine |
| SMILES | CC(=O)c1cccc(C(=O)O)c1O.CCOc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C9H13N3O.C9H8O4/c1-2-13-8-5-3-7(4-6-8)12-9(10)11;1-5(10)6-3-2-4-7(8(6)11)9(12)13/h3-6H,2H2,1H3,(H4,10,11,12);2-4,11H,1H3,(H,12,13) |
| InChIKey | IIJZWBNNNKOWJK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|