C25H18N2O9 — CID 71516881
bis(4-acetyl-2-nitrosophenyl) 4-methoxybenzene-1,3-dicarboxylate (PubChem CID 71516881) has the molecular formula C25H18N2O9 and a molecular weight of 490.42 g/mol. Its IUPAC name is bis(4-acetyl-2-nitrosophenyl) 4-methoxybenzene-1,3-dicarboxylate.
| Compound Name | bis(4-acetyl-2-nitrosophenyl) 4-methoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71516881 |
| Molecular Formula | C25H18N2O9 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | bis(4-acetyl-2-nitrosophenyl) 4-methoxybenzene-1,3-dicarboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(C)=O)cc2N=O)cc1C(=O)Oc1ccc(C(C)=O)cc1N=O |
| InChI | InChI=1S/C25H18N2O9/c1-13(28)15-4-8-22(19(11-15)26-32)35-24(30)17-6-7-21(34-3)18(10-17)25(31)36-23-9-5-16(14(2)29)12-20(23)27-33/h4-12H,1-3H3 |
| InChIKey | CEXCABUXFDEISV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 154.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|