C14H10BrClF2N2OS — CID 4846322
1-(4-bromo-2-chlorophenyl)-3-[4-(difluoromethoxy)phenyl]thiourea (PubChem CID 4846322) has the molecular formula C14H10BrClF2N2OS and a molecular weight of 407.67 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[4-(difluoromethoxy)phenyl]thiourea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[4-(difluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 4846322 |
| Molecular Formula | C14H10BrClF2N2OS |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[4-(difluoromethoxy)phenyl]thiourea |
| SMILES | FC(F)Oc1ccc(NC(=S)Nc2ccc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10BrClF2N2OS/c15-8-1-6-12(11(16)7-8)20-14(22)19-9-2-4-10(5-3-9)21-13(17)18/h1-7,13H,(H2,19,20,22) |
| InChIKey | JLIVTKMNBPIRGB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|