About [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate
[4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 3642298) has the molecular formula C22H16Cl3N3O3S
and a molecular weight of 508.81 g/mol. Its IUPAC name is [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate.
Molecular Properties
| Compound Name | [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
| PubChem CID | 3642298 |
| Molecular Formula | C22H16Cl3N3O3S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=S)Nc2cccc(Cl)c2)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16Cl3N3O3S/c1-30-20-9-13(12-26-28-22(32)27-16-4-2-3-14(23)10-16)5-8-19(20)31-21(29)17-7-6-15(24)11-18(17)25/h2-12H,1H3,(H2,27,28,32) |
| InChIKey | BIPDJFHDGHGSHI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate?
The IUPAC name of [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate (CID 3642298) is [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate.
What is the SMILES notation for [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate?
The canonical SMILES for [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate is COc1cc(C=NNC(=S)Nc2cccc(Cl)c2)ccc1OC(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate?
The InChIKey is BIPDJFHDGHGSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl3N3O3S/c1-30-20-9-13(12-26-28-22(32)27-16-4-2-3-14(23)10-16)5-8-19(20)31-21(29)17-7-6-15(24)11-18(17)25/h2-12H,1H3,(H2,27,28,32).
What are the key properties of [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate?
[4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate has a molecular weight of 508.81 g/mol, XLogP of 6.20, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(3-chlorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate is sourced from PubChem (CID 3642298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).