C23H16Cl3N3O5 — CID 4290170
[4-[[[2-(4-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 4290170) has the molecular formula C23H16Cl3N3O5 and a molecular weight of 520.76 g/mol. Its IUPAC name is [4-[[[2-(4-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[[2-(4-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4290170 |
| Molecular Formula | C23H16Cl3N3O5 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | [4-[[[2-(4-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccc(Cl)cc2)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H16Cl3N3O5/c1-33-20-10-13(2-9-19(20)34-23(32)17-8-5-15(25)11-18(17)26)12-27-29-22(31)21(30)28-16-6-3-14(24)4-7-16/h2-12H,1H3,(H,28,30)(H,29,31) |
| InChIKey | UNEXMQYNNMBXGF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|