C25H26N6O4S — CID 168618922
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-methoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 168618922) has the molecular formula C25H26N6O4S and a molecular weight of 506.59 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-methoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-methoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 168618922 |
| Molecular Formula | C25H26N6O4S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-methoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | COc1cc(C=NNc2nc(C)cs2)ccc1OCC(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C25H26N6O4S/c1-16-15-36-25(27-16)29-26-13-18-10-11-20(21(12-18)34-4)35-14-22(32)28-23-17(2)30(3)31(24(23)33)19-8-6-5-7-9-19/h5-13,15H,14H2,1-4H3,(H,27,29)(H,28,32) |
| InChIKey | FABDSCVXPIPICN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|