C18H17N5O2S — CID 168618323
2-[4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-pyridin-2-ylacetamide (PubChem CID 168618323) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 168618323 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-pyridin-2-ylacetamide |
| SMILES | Cc1csc(NN=Cc2ccc(OCC(=O)Nc3ccccn3)cc2)n1 |
| InChI | InChI=1S/C18H17N5O2S/c1-13-12-26-18(21-13)23-20-10-14-5-7-15(8-6-14)25-11-17(24)22-16-4-2-3-9-19-16/h2-10,12H,11H2,1H3,(H,21,23)(H,19,22,24) |
| InChIKey | RRIFRTLBHJYWFB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|