C20H20BrN5O3S — CID 168535385
[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea (PubChem CID 168535385) has the molecular formula C20H20BrN5O3S and a molecular weight of 490.38 g/mol. Its IUPAC name is [[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535385 |
| Molecular Formula | C20H20BrN5O3S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]thiourea |
| SMILES | COc1cc(C=NNC(N)=S)ccc1OCc1c(Br)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H20BrN5O3S/c1-25-15(18(21)19(27)26(25)14-6-4-3-5-7-14)12-29-16-9-8-13(10-17(16)28-2)11-23-24-20(22)30/h3-11H,12H2,1-2H3,(H3,22,24,30) |
| InChIKey | ZROATZLDRWGBLX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|