C28H21BrN2O5 — CID 4174756
2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylidene]indene-1,3-dione (PubChem CID 4174756) has the molecular formula C28H21BrN2O5 and a molecular weight of 545.39 g/mol. Its IUPAC name is 2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 4174756 |
| Molecular Formula | C28H21BrN2O5 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylidene]indene-1,3-dione |
| SMILES | COc1cc(C=C2C(=O)c3ccccc3C2=O)ccc1OCc1c(Br)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H21BrN2O5/c1-30-22(25(29)28(34)31(30)18-8-4-3-5-9-18)16-36-23-13-12-17(15-24(23)35-2)14-21-26(32)19-10-6-7-11-20(19)27(21)33/h3-15H,16H2,1-2H3 |
| InChIKey | XEICVKCRMSAVGS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|