C21H22BrN3O3 — CID 57365426
5-[[2-[1-(aminomethoxy)prop-1-en-2-yl]phenoxy]methyl]-4-bromo-1-methyl-2-phenylpyrazol-3-one (PubChem CID 57365426) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 5-[[2-[1-(aminomethoxy)prop-1-en-2-yl]phenoxy]methyl]-4-bromo-1-methyl-2-phenylpyrazol-3-one.
| Compound Name | 5-[[2-[1-(aminomethoxy)prop-1-en-2-yl]phenoxy]methyl]-4-bromo-1-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 57365426 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 5-[[2-[1-(aminomethoxy)prop-1-en-2-yl]phenoxy]methyl]-4-bromo-1-methyl-2-phenylpyrazol-3-one |
| SMILES | CC(=COCN)c1ccccc1OCc1c(Br)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H22BrN3O3/c1-15(12-27-14-23)17-10-6-7-11-19(17)28-13-18-20(22)21(26)25(24(18)2)16-8-4-3-5-9-16/h3-12H,13-14,23H2,1-2H3 |
| InChIKey | DSKUTAFPQVKUCD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|