C20H21BrN6O3 — CID 168592485
2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]guanidine (PubChem CID 168592485) has the molecular formula C20H21BrN6O3 and a molecular weight of 473.33 g/mol. Its IUPAC name is 2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592485 |
| Molecular Formula | C20H21BrN6O3 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-[[4-[(4-bromo-2-methyl-5-oxo-1-phenylpyrazol-3-yl)methoxy]-3-methoxyphenyl]methylideneamino]guanidine |
| SMILES | COc1cc(C=NN=C(N)N)ccc1OCc1c(Br)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H21BrN6O3/c1-26-15(18(21)19(28)27(26)14-6-4-3-5-7-14)12-30-16-9-8-13(10-17(16)29-2)11-24-25-20(22)23/h3-11H,12H2,1-2H3,(H4,22,23,25) |
| InChIKey | ZLQCYJFSIYGGLO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|