C15H24N4O — CID 168532139
[[4-[[di(propan-2-yl)amino]methyl]phenyl]methylideneamino]urea (PubChem CID 168532139) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is [[4-[[di(propan-2-yl)amino]methyl]phenyl]methylideneamino]urea.
| Compound Name | [[4-[[di(propan-2-yl)amino]methyl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532139 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | [[4-[[di(propan-2-yl)amino]methyl]phenyl]methylideneamino]urea |
| SMILES | CC(C)N(Cc1ccc(C=NNC(N)=O)cc1)C(C)C |
| InChI | InChI=1S/C15H24N4O/c1-11(2)19(12(3)4)10-14-7-5-13(6-8-14)9-17-18-15(16)20/h5-9,11-12H,10H2,1-4H3,(H3,16,18,20) |
| InChIKey | YRMZKLMFDIHNJJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|