C14H21N5O — CID 168532010
[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]urea (PubChem CID 168532010) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is [[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]urea.
| Compound Name | [[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532010 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | [[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]urea |
| SMILES | CN1CCN(Cc2ccc(C=NNC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C14H21N5O/c1-18-6-8-19(9-7-18)11-13-4-2-12(3-5-13)10-16-17-14(15)20/h2-5,10H,6-9,11H2,1H3,(H3,15,17,20) |
| InChIKey | SPKOUULVUWHTPF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|