C24H21ClN4O6 — CID 26368110
methyl 4-chloro-3-[5-[(Z)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 26368110) has the molecular formula C24H21ClN4O6 and a molecular weight of 496.91 g/mol. Its IUPAC name is methyl 4-chloro-3-[5-[(Z)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-chloro-3-[5-[(Z)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 26368110 |
| Molecular Formula | C24H21ClN4O6 |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | methyl 4-chloro-3-[5-[(Z)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | COCc1cc(C)n(CC(=O)N/N=C\c2ccc(-c3cc(C(=O)OC)ccc3Cl)o2)c(=O)c1C#N |
| InChI | InChI=1S/C24H21ClN4O6/c1-14-8-16(13-33-2)19(10-26)23(31)29(14)12-22(30)28-27-11-17-5-7-21(35-17)18-9-15(24(32)34-3)4-6-20(18)25/h4-9,11H,12-13H2,1-3H3,(H,28,30)/b27-11- |
| InChIKey | CZUGUJNTHSFGSD-BCHBDCPOSA-N |
| XLogP | 3.03 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|