C18H16BrN5O6 — CID 136700931
N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetamide (PubChem CID 136700931) has the molecular formula C18H16BrN5O6 and a molecular weight of 478.26 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 136700931 |
| Molecular Formula | C18H16BrN5O6 |
| Molecular Weight | 478.26 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetamide |
| SMILES | COCc1cc(C)n(CC(=O)N/N=C/c2cc(Br)cc([N+](=O)[O-])c2O)c(=O)c1C#N |
| InChI | InChI=1S/C18H16BrN5O6/c1-10-3-12(9-30-2)14(6-20)18(27)23(10)8-16(25)22-21-7-11-4-13(19)5-15(17(11)26)24(28)29/h3-5,7,26H,8-9H2,1-2H3,(H,22,25)/b21-7+ |
| InChIKey | OTJNZQKKOFUVFS-QPSGOUHRSA-N |
| XLogP | 1.70 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|