C24H25FN2O2 — CID 110504955
N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline (PubChem CID 110504955) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110504955 |
| Molecular Formula | C24H25FN2O2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
| SMILES | CCOc1cc(/C=N/Nc2ccc(C)c(C)c2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C24H25FN2O2/c1-4-28-24-14-19(15-26-27-21-11-9-17(2)18(3)13-21)10-12-23(24)29-16-20-7-5-6-8-22(20)25/h5-15,27H,4,16H2,1-3H3/b26-15+ |
| InChIKey | YIKWSUDSEIDIDY-CVKSISIWSA-N |
| XLogP | 5.87 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|