C30H24F3N3O5 — CID 66637894
3,4-dimethoxy-N-[2-[[[3-[3-(trifluoromethyl)phenoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 66637894) has the molecular formula C30H24F3N3O5 and a molecular weight of 563.53 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-[[[3-[3-(trifluoromethyl)phenoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-[[[3-[3-(trifluoromethyl)phenoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 66637894 |
| Molecular Formula | C30H24F3N3O5 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | 3,4-dimethoxy-N-[2-[[[3-[3-(trifluoromethyl)phenoxy]phenyl]methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)NN=Cc2cccc(Oc3cccc(C(F)(F)F)c3)c2)cc1OC |
| InChI | InChI=1S/C30H24F3N3O5/c1-39-26-14-13-20(16-27(26)40-2)28(37)35-25-12-4-3-11-24(25)29(38)36-34-18-19-7-5-9-22(15-19)41-23-10-6-8-21(17-23)30(31,32)33/h3-18H,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | SSTIWPLYYAMEQP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|