C23H19ClF3N3O4S — CID 66638264
N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxamide (PubChem CID 66638264) has the molecular formula C23H19ClF3N3O4S and a molecular weight of 525.94 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxamide.
| Compound Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 66638264 |
| Molecular Formula | C23H19ClF3N3O4S |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]-2-[(3,4-dimethoxybenzoyl)amino]-4-methylthiophene-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2scc(C)c2C(=O)NN=Cc2ccc(Cl)c(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C23H19ClF3N3O4S/c1-12-11-35-22(29-20(31)14-5-7-17(33-2)18(9-14)34-3)19(12)21(32)30-28-10-13-4-6-16(24)15(8-13)23(25,26)27/h4-11H,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | KEIFEZIFSRZKGH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|