C27H28FN3O3S2 — CID 66639584
N-[(4-fluorophenyl)methylideneamino]-2-[[3-(3-hydroxypropylsulfanylmethyl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 66639584) has the molecular formula C27H28FN3O3S2 and a molecular weight of 525.67 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methylideneamino]-2-[[3-(3-hydroxypropylsulfanylmethyl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methylideneamino]-2-[[3-(3-hydroxypropylsulfanylmethyl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 66639584 |
| Molecular Formula | C27H28FN3O3S2 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-[(4-fluorophenyl)methylideneamino]-2-[[3-(3-hydroxypropylsulfanylmethyl)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1sc2c(c1C(=O)NN=Cc1ccc(F)cc1)CCCC2)c1cccc(CSCCCO)c1 |
| InChI | InChI=1S/C27H28FN3O3S2/c28-21-11-9-18(10-12-21)16-29-31-26(34)24-22-7-1-2-8-23(22)36-27(24)30-25(33)20-6-3-5-19(15-20)17-35-14-4-13-32/h3,5-6,9-12,15-16,32H,1-2,4,7-8,13-14,17H2,(H,30,33)(H,31,34) |
| InChIKey | TXXMHQMYEUHJIK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|