C16H12Cl2N4OS — CID 20597602
N-(3,4-dichlorophenyl)-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide (PubChem CID 20597602) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 20597602 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cccc(CSc2ncn[nH]2)c1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-13-5-4-12(7-14(13)18)21-15(23)11-3-1-2-10(6-11)8-24-16-19-9-20-22-16/h1-7,9H,8H2,(H,21,23)(H,19,20,22) |
| InChIKey | BZWRXAUAOBOYKD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |