C23H23IN4O2S — CID 126250893
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126250893) has the molecular formula C23H23IN4O2S and a molecular weight of 546.43 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126250893 |
| Molecular Formula | C23H23IN4O2S |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(COc2ccc(/C=N\NC(=O)CSc3nc(C)cc(C)n3)cc2I)cc1 |
| InChI | InChI=1S/C23H23IN4O2S/c1-15-4-6-18(7-5-15)13-30-21-9-8-19(11-20(21)24)12-25-28-22(29)14-31-23-26-16(2)10-17(3)27-23/h4-12H,13-14H2,1-3H3,(H,28,29)/b25-12- |
| InChIKey | HSGKOCFDGXDCEU-ROTLSHHCSA-N |
| XLogP | 4.83 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|