C16H20ClN3O6 — CID 8989926
2-[4-[(Z)-[[2-[[(2S)-butan-2-yl]amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid (PubChem CID 8989926) has the molecular formula C16H20ClN3O6 and a molecular weight of 385.80 g/mol. Its IUPAC name is 2-[4-[(Z)-[[2-[[(2S)-butan-2-yl]amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[[2-[[(2S)-butan-2-yl]amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 8989926 |
| Molecular Formula | C16H20ClN3O6 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[4-[(Z)-[[2-[[(2S)-butan-2-yl]amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-chloro-6-methoxyphenoxy]acetic acid |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cc(Cl)c(OCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H20ClN3O6/c1-4-9(2)19-15(23)16(24)20-18-7-10-5-11(17)14(12(6-10)25-3)26-8-13(21)22/h5-7,9H,4,8H2,1-3H3,(H,19,23)(H,20,24)(H,21,22)/b18-7-/t9-/m0/s1 |
| InChIKey | PYQODLRIOANBCE-OQTYBLBQSA-N |
| XLogP | 1.18 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|