C22H21N3O5 — CID 9352883
N-(furan-2-ylmethyl)-N'-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]oxamide (PubChem CID 9352883) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 9352883 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(/C=N\NC(=O)C(=O)NCc2ccco2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O5/c1-28-19-10-9-17(12-20(19)30-15-16-6-3-2-4-7-16)13-24-25-22(27)21(26)23-14-18-8-5-11-29-18/h2-13H,14-15H2,1H3,(H,23,26)(H,25,27)/b24-13- |
| InChIKey | LRLCUIFBHTZVET-CFRMEGHHSA-N |
| XLogP | 2.63 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|