C19H16N3O7- — CID 8989534
2-[2-[(Z)-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 8989534) has the molecular formula C19H16N3O7- and a molecular weight of 398.35 g/mol. Its IUPAC name is 2-[2-[(Z)-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8989534 |
| Molecular Formula | C19H16N3O7- |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[2-[(Z)-[[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1/C=N\NC(=O)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17N3O7/c23-17(24)10-27-14-4-2-1-3-13(14)9-21-22-19(26)18(25)20-8-12-5-6-15-16(7-12)29-11-28-15/h1-7,9H,8,10-11H2,(H,20,25)(H,22,26)(H,23,24)/p-1/b21-9- |
| InChIKey | NTCYDWCBQRBICF-NKVSQWTQSA-M |
| XLogP | -0.69 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|